C31H33N3O6S — CID 68510761
2-[[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68510761) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is 2-[[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | 2-[[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68510761 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)c2cc(C)c(C)o2)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H33N3O6S/c1-5-34(6-2)31(37)27(29(35)33-41(38,39)26-16-13-23-9-7-8-10-24(23)19-26)18-22-11-14-25(15-12-22)32-30(36)28-17-20(3)21(4)40-28/h7-17,19,27H,5-6,18H2,1-4H3,(H,32,36)(H,33,35) |
| InChIKey | KLSAJOWDTUQNSN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|