C30H30N4O5S — CID 68508801
N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[3-(pyridine-2-carbonylamino)phenyl]methyl]propanediamide (PubChem CID 68508801) has the molecular formula C30H30N4O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[3-(pyridine-2-carbonylamino)phenyl]methyl]propanediamide.
| Compound Name | N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[3-(pyridine-2-carbonylamino)phenyl]methyl]propanediamide |
|---|---|
| PubChem CID | 68508801 |
| Molecular Formula | C30H30N4O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[3-(pyridine-2-carbonylamino)phenyl]methyl]propanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1cccc(NC(=O)c2ccccn2)c1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H30N4O5S/c1-3-34(4-2)30(37)26(19-21-10-9-13-24(18-21)32-29(36)27-14-7-8-17-31-27)28(35)33-40(38,39)25-16-15-22-11-5-6-12-23(22)20-25/h5-18,20,26H,3-4,19H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | RCURKYSDXGUFEX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|