C29H33N3O5S — CID 68511558
N,N-diethyl-2-[[4-[(1-methylcyclopropanecarbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68511558) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is N,N-diethyl-2-[[4-[(1-methylcyclopropanecarbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | N,N-diethyl-2-[[4-[(1-methylcyclopropanecarbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68511558 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N,N-diethyl-2-[[4-[(1-methylcyclopropanecarbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)C2(C)CC2)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H33N3O5S/c1-4-32(5-2)27(34)25(18-20-10-13-23(14-11-20)30-28(35)29(3)16-17-29)26(33)31-38(36,37)24-15-12-21-8-6-7-9-22(21)19-24/h6-15,19,25H,4-5,16-18H2,1-3H3,(H,30,35)(H,31,33) |
| InChIKey | MNNUNYUJHYFUTD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|