C32H32N4O5S — CID 68507325
N-[4-[2-(4-methylpiperazine-1-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide (PubChem CID 68507325) has the molecular formula C32H32N4O5S and a molecular weight of 584.70 g/mol. Its IUPAC name is N-[4-[2-(4-methylpiperazine-1-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(4-methylpiperazine-1-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide |
|---|---|
| PubChem CID | 68507325 |
| Molecular Formula | C32H32N4O5S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | N-[4-[2-(4-methylpiperazine-1-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide |
| SMILES | CN1CCN(C(=O)C(Cc2ccc(NC(=O)c3ccccc3)cc2)C(=O)NS(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C32H32N4O5S/c1-35-17-19-36(20-18-35)32(39)29(21-23-11-14-27(15-12-23)33-30(37)25-8-3-2-4-9-25)31(38)34-42(40,41)28-16-13-24-7-5-6-10-26(24)22-28/h2-16,22,29H,17-21H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | VARIBINCCDDUKA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|