C24H23N3O4S — CID 68508393
2-(2-cyanoethyl)-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide (PubChem CID 68508393) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-(2-cyanoethyl)-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide.
| Compound Name | 2-(2-cyanoethyl)-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide |
|---|---|
| PubChem CID | 68508393 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-(2-cyanoethyl)-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide |
| SMILES | CCN(C(=O)C(CCC#N)C(=O)NS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-2-27(20-11-4-3-5-12-20)24(29)22(13-8-16-25)23(28)26-32(30,31)21-15-14-18-9-6-7-10-19(18)17-21/h3-7,9-12,14-15,17,22H,2,8,13H2,1H3,(H,26,28) |
| InChIKey | BIXHJSVEXOQXNN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|