C16H14N2O4S — CID 1491108
(2R)-2-(benzenesulfonamido)-3-(4-cyanophenyl)propanoic acid (PubChem CID 1491108) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)-3-(4-cyanophenyl)propanoic acid.
| Compound Name | (2R)-2-(benzenesulfonamido)-3-(4-cyanophenyl)propanoic acid |
|---|---|
| PubChem CID | 1491108 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)-3-(4-cyanophenyl)propanoic acid |
| SMILES | N#Cc1ccc(C[C@@H](NS(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H14N2O4S/c17-11-13-8-6-12(7-9-13)10-15(16(19)20)18-23(21,22)14-4-2-1-3-5-14/h1-9,15,18H,10H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | BEGPCWOPUVAXQP-OAHLLOKOSA-N |
| XLogP | 1.53 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |