C16H13FN2O4S — CID 151395385
2-[(4-cyanophenyl)sulfonylamino]-3-(2-fluorophenyl)propanoic acid (PubChem CID 151395385) has the molecular formula C16H13FN2O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonylamino]-3-(2-fluorophenyl)propanoic acid.
| Compound Name | 2-[(4-cyanophenyl)sulfonylamino]-3-(2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 151395385 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonylamino]-3-(2-fluorophenyl)propanoic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(Cc2ccccc2F)C(=O)O)cc1 |
| InChI | InChI=1S/C16H13FN2O4S/c17-14-4-2-1-3-12(14)9-15(16(20)21)19-24(22,23)13-7-5-11(10-18)6-8-13/h1-8,15,19H,9H2,(H,20,21) |
| InChIKey | OVIJOGOZRHRGJA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |