C27H28N6O3S — CID 20595110
5-methyl-N-[4-(piperidine-1-carboximidoyl)phenyl]-2-(3-sulfamoylnaphthalen-2-yl)pyrazole-3-carboxamide (PubChem CID 20595110) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is 5-methyl-N-[4-(piperidine-1-carboximidoyl)phenyl]-2-(3-sulfamoylnaphthalen-2-yl)pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[4-(piperidine-1-carboximidoyl)phenyl]-2-(3-sulfamoylnaphthalen-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 20595110 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 5-methyl-N-[4-(piperidine-1-carboximidoyl)phenyl]-2-(3-sulfamoylnaphthalen-2-yl)pyrazole-3-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C)nn2-c2cc3ccccc3cc2S(N)(=O)=O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C27H28N6O3S/c1-18-15-24(27(34)30-22-11-9-19(10-12-22)26(28)32-13-5-2-6-14-32)33(31-18)23-16-20-7-3-4-8-21(20)17-25(23)37(29,35)36/h3-4,7-12,15-17,28H,2,5-6,13-14H2,1H3,(H,30,34)(H2,29,35,36)/b28-26- |
| InChIKey | FZGQSPMFVCJHFN-SGEDCAFJSA-N |
| XLogP | 4.04 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|