C25H24FN5O4S — CID 20616808
methyl 3-[5-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]carbamoyl]-3-methylpyrazol-1-yl]naphthalene-2-sulfonate (PubChem CID 20616808) has the molecular formula C25H24FN5O4S and a molecular weight of 509.56 g/mol. Its IUPAC name is methyl 3-[5-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]carbamoyl]-3-methylpyrazol-1-yl]naphthalene-2-sulfonate.
| Compound Name | methyl 3-[5-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]carbamoyl]-3-methylpyrazol-1-yl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 20616808 |
| Molecular Formula | C25H24FN5O4S |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | methyl 3-[5-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]carbamoyl]-3-methylpyrazol-1-yl]naphthalene-2-sulfonate |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C)nn2-c2cc3ccccc3cc2S(=O)(=O)OC)c(F)c1)N(C)C |
| InChI | InChI=1S/C25H24FN5O4S/c1-15-11-22(25(32)28-20-10-9-18(12-19(20)26)24(27)30(2)3)31(29-15)21-13-16-7-5-6-8-17(16)14-23(21)36(33,34)35-4/h5-14,27H,1-4H3,(H,28,32)/b27-24- |
| InChIKey | GHZLLURGOBVKBX-PNHLSOANSA-N |
| XLogP | 3.95 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|