C18H18N6O3S — CID 141001791
2-(4-carbamimidoylphenyl)-5-methyl-N-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 141001791) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 2-(4-carbamimidoylphenyl)-5-methyl-N-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | 2-(4-carbamimidoylphenyl)-5-methyl-N-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141001791 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-(4-carbamimidoylphenyl)-5-methyl-N-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(-n2nc(C)cc2C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H18N6O3S/c1-11-10-16(24(23-11)14-6-2-12(3-7-14)17(19)20)18(25)22-13-4-8-15(9-5-13)28(21,26)27/h2-10H,1H3,(H3,19,20)(H,22,25)(H2,21,26,27) |
| InChIKey | VINCAILVAZNSFK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|