C21H22N6O2 — CID 18549495
2-(3-carbamimidoylphenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 18549495) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-(3-carbamimidoylphenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 18549495 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(3-carbamimidoylphenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(-n2nc(C)cc2C(=O)Nc2ccc(C(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-13-11-18(27(25-13)17-6-4-5-15(12-17)19(22)23)20(28)24-16-9-7-14(8-10-16)21(29)26(2)3/h4-12H,1-3H3,(H3,22,23)(H,24,28) |
| InChIKey | QKULPARRWGPSBA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|