C22H26N6O — CID 18549278
2-(3-carbamimidoylphenyl)-N-[4-(diethylamino)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 18549278) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenyl)-N-[4-(diethylamino)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-(3-carbamimidoylphenyl)-N-[4-(diethylamino)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 18549278 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-(3-carbamimidoylphenyl)-N-[4-(diethylamino)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(-n2nc(C)cc2C(=O)Nc2ccc(N(CC)CC)cc2)c1 |
| InChI | InChI=1S/C22H26N6O/c1-4-27(5-2)18-11-9-17(10-12-18)25-22(29)20-13-15(3)26-28(20)19-8-6-7-16(14-19)21(23)24/h6-14H,4-5H2,1-3H3,(H3,23,24)(H,25,29) |
| InChIKey | AWHDJSQIBWYAHP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|