C24H20FN5O — CID 54231096
2-(3-carbamimidoylphenyl)-N-[4-(4-fluorophenyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 54231096) has the molecular formula C24H20FN5O and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenyl)-N-[4-(4-fluorophenyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-(3-carbamimidoylphenyl)-N-[4-(4-fluorophenyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 54231096 |
| Molecular Formula | C24H20FN5O |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(3-carbamimidoylphenyl)-N-[4-(4-fluorophenyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(-n2nc(C)cc2C(=O)Nc2ccc(-c3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C24H20FN5O/c1-15-13-22(30(29-15)21-4-2-3-18(14-21)23(26)27)24(31)28-20-11-7-17(8-12-20)16-5-9-19(25)10-6-16/h2-14H,1H3,(H3,26,27)(H,28,31) |
| InChIKey | QJHVWSMCSPIHLI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|