C23H17F2N3O — CID 4638093
1,3-bis(4-fluorophenyl)-N-(4-methylphenyl)pyrazole-5-carboxamide (PubChem CID 4638093) has the molecular formula C23H17F2N3O and a molecular weight of 389.41 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)-N-(4-methylphenyl)pyrazole-5-carboxamide.
| Compound Name | 1,3-bis(4-fluorophenyl)-N-(4-methylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4638093 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)-N-(4-methylphenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3)nn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H17F2N3O/c1-15-2-10-19(11-3-15)26-23(29)22-14-21(16-4-6-17(24)7-5-16)27-28(22)20-12-8-18(25)9-13-20/h2-14H,1H3,(H,26,29) |
| InChIKey | ZKWKZWJPVWXVGY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |