C18H13FN4O — CID 174832757
N-(4-cyanophenyl)-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 174832757) has the molecular formula C18H13FN4O and a molecular weight of 320.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(4-cyanophenyl)-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174832757 |
| Molecular Formula | C18H13FN4O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-(4-cyanophenyl)-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H13FN4O/c1-23-17(10-16(22-23)13-4-6-14(19)7-5-13)18(24)21-15-8-2-12(11-20)3-9-15/h2-10H,1H3,(H,21,24) |
| InChIKey | VTTWXVSCCJXTDF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |