C29H22N4O — CID 21306376
N-[4-(2-cyanophenyl)phenyl]-5-methyl-2-(3-methylnaphthalen-2-yl)pyrazole-3-carboxamide (PubChem CID 21306376) has the molecular formula C29H22N4O and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[4-(2-cyanophenyl)phenyl]-5-methyl-2-(3-methylnaphthalen-2-yl)pyrazole-3-carboxamide.
| Compound Name | N-[4-(2-cyanophenyl)phenyl]-5-methyl-2-(3-methylnaphthalen-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 21306376 |
| Molecular Formula | C29H22N4O |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[4-(2-cyanophenyl)phenyl]-5-methyl-2-(3-methylnaphthalen-2-yl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(-c3ccccc3C#N)cc2)n(-c2cc3ccccc3cc2C)n1 |
| InChI | InChI=1S/C29H22N4O/c1-19-15-22-7-3-4-8-23(22)17-27(19)33-28(16-20(2)32-33)29(34)31-25-13-11-21(12-14-25)26-10-6-5-9-24(26)18-30/h3-17H,1-2H3,(H,31,34) |
| InChIKey | MTKCZBRVRFRSLN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |