C23H19F2N7O — CID 21366448
1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide (PubChem CID 21366448) has the molecular formula C23H19F2N7O and a molecular weight of 447.45 g/mol. Its IUPAC name is 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide.
| Compound Name | 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366448 |
| Molecular Formula | C23H19F2N7O |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-(3-fluoronaphthalen-2-yl)-N-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]tetrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2nnnn2-c2cc3ccccc3cc2F)c(F)c1)N1CCCC1 |
| InChI | InChI=1S/C23H19F2N7O/c24-17-12-16(21(26)31-9-3-4-10-31)7-8-19(17)27-23(33)22-28-29-30-32(22)20-13-15-6-2-1-5-14(15)11-18(20)25/h1-2,5-8,11-13,26H,3-4,9-10H2,(H,27,33)/b26-21- |
| InChIKey | JLIOHWNTJTXGTP-QLYXXIJNSA-N |
| XLogP | 3.77 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|