C24H22FN7O — CID 20595265
N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-1-naphthalen-2-yltetrazole-5-carboxamide (PubChem CID 20595265) has the molecular formula C24H22FN7O and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-1-naphthalen-2-yltetrazole-5-carboxamide.
| Compound Name | N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-1-naphthalen-2-yltetrazole-5-carboxamide |
|---|---|
| PubChem CID | 20595265 |
| Molecular Formula | C24H22FN7O |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-1-naphthalen-2-yltetrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2nnnn2-c2ccc3ccccc3c2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H22FN7O/c25-20-15-18(22(26)31-12-4-1-5-13-31)9-11-21(20)27-24(33)23-28-29-30-32(23)19-10-8-16-6-2-3-7-17(16)14-19/h2-3,6-11,14-15,26H,1,4-5,12-13H2,(H,27,33)/b26-22- |
| InChIKey | IWHGHJSQXRXPDK-ROMGYVFFSA-N |
| XLogP | 4.02 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|