C11H12ClFN2 — CID 63179175
(3-chloro-4-fluorophenyl)-pyrrolidin-1-ylmethanimine (PubChem CID 63179175) has the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-pyrrolidin-1-ylmethanimine.
| Compound Name | (3-chloro-4-fluorophenyl)-pyrrolidin-1-ylmethanimine |
|---|---|
| PubChem CID | 63179175 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-pyrrolidin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1ccc(F)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C11H12ClFN2/c12-9-7-8(3-4-10(9)13)11(14)15-5-1-2-6-15/h3-4,7,14H,1-2,5-6H2/b14-11- |
| InChIKey | MPLNNCKCDFGTHF-KAMYIIQDSA-N |
| XLogP | 2.90 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|