C27H24Cl2FN3O2 — CID 147923757
5-chloro-N-(4-chlorophenyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 147923757) has the molecular formula C27H24Cl2FN3O2 and a molecular weight of 512.41 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | 5-chloro-N-(4-chlorophenyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 147923757 |
| Molecular Formula | C27H24Cl2FN3O2 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cc2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C27H24Cl2FN3O2/c28-19-7-9-21(10-8-19)32-27(35)23-16-20(29)6-4-17(23)15-25(34)22-11-5-18(14-24(22)30)26(31)33-12-2-1-3-13-33/h4-11,14,16,31H,1-3,12-13,15H2,(H,32,35)/b31-26- |
| InChIKey | IINMRKHRGPOTAM-ZXPTYKNPSA-N |
| XLogP | 6.62 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|