C28H29Cl2N5O2 — CID 18727814
5-chloro-N-(4-chlorophenyl)-3-(dimethylamino)-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide (PubChem CID 18727814) has the molecular formula C28H29Cl2N5O2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-3-(dimethylamino)-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(4-chlorophenyl)-3-(dimethylamino)-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 18727814 |
| Molecular Formula | C28H29Cl2N5O2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-3-(dimethylamino)-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(C(=O)Nc3ccc(Cl)cc3)cc(Cl)cc2N(C)C)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H29Cl2N5O2/c1-34(2)24-17-21(30)16-23(28(37)32-22-12-10-20(29)11-13-22)25(24)33-27(36)19-8-6-18(7-9-19)26(31)35-14-4-3-5-15-35/h6-13,16-17,31H,3-5,14-15H2,1-2H3,(H,32,37)(H,33,36)/b31-26- |
| InChIKey | UAFUPDBKUVTFFG-ZXPTYKNPSA-N |
| XLogP | 6.38 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|