C27H25Cl2N3O2 — CID 158539100
5-chloro-N-(4-chlorophenyl)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide (PubChem CID 158539100) has the molecular formula C27H25Cl2N3O2 and a molecular weight of 494.42 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide.
| Compound Name | 5-chloro-N-(4-chlorophenyl)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 158539100 |
| Molecular Formula | C27H25Cl2N3O2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C27H25Cl2N3O2/c28-21-10-12-23(13-11-21)31-27(34)24-17-22(29)9-8-20(24)16-25(33)18-4-6-19(7-5-18)26(30)32-14-2-1-3-15-32/h4-13,17,30H,1-3,14-16H2,(H,31,34)/b30-26- |
| InChIKey | GTRGABFBDDNKLW-BXVZCJGGSA-N |
| XLogP | 6.48 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|