C27H30Cl2N4O — CID 161013307
5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide;methane (PubChem CID 161013307) has the molecular formula C27H30Cl2N4O and a molecular weight of 497.47 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide;methane.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide;methane |
|---|---|
| PubChem CID | 161013307 |
| Molecular Formula | C27H30Cl2N4O |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide;methane |
| SMILES | C.[H]/N=C(/c1ccc(CCc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C26H26Cl2N4O.CH4/c27-21-11-10-19(23(16-21)26(33)31-24-13-12-22(28)17-30-24)7-4-18-5-8-20(9-6-18)25(29)32-14-2-1-3-15-32;/h5-6,8-13,16-17,29H,1-4,7,14-15H2,(H,30,31,33);1H4/b29-25-; |
| InChIKey | TXJXVRRWIPKZET-PKPTZPFZSA-N |
| XLogP | 6.87 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|