C23H23ClFN3O — CID 161034320
N-(5-chloro-2-pyridinyl)-2-[2-(4-ethanimidoylphenyl)ethyl]-5-fluorobenzamide;methane (PubChem CID 161034320) has the molecular formula C23H23ClFN3O and a molecular weight of 411.91 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-(4-ethanimidoylphenyl)ethyl]-5-fluorobenzamide;methane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-(4-ethanimidoylphenyl)ethyl]-5-fluorobenzamide;methane |
|---|---|
| PubChem CID | 161034320 |
| Molecular Formula | C23H23ClFN3O |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-(4-ethanimidoylphenyl)ethyl]-5-fluorobenzamide;methane |
| SMILES | C.[H]/N=C(\C)c1ccc(CCc2ccc(F)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C22H19ClFN3O.CH4/c1-14(25)16-5-2-15(3-6-16)4-7-17-8-10-19(24)12-20(17)22(28)27-21-11-9-18(23)13-26-21;/h2-3,5-6,8-13,25H,4,7H2,1H3,(H,26,27,28);1H4/b25-14+; |
| InChIKey | UAAYJZGNAGIALJ-WJKHLOCDSA-N |
| XLogP | 5.94 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|