C22H20ClN5O2 — CID 140603963
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-ethanimidoyl-2-(methylamino)benzamide (PubChem CID 140603963) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-ethanimidoyl-2-(methylamino)benzamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-ethanimidoyl-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 140603963 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-ethanimidoyl-2-(methylamino)benzamide |
| SMILES | [H]/N=C(\C)c1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cn2)c(NC)c1 |
| InChI | InChI=1S/C22H20ClN5O2/c1-13(24)14-7-9-17(19(11-14)25-2)21(29)27-18-6-4-3-5-16(18)22(30)28-20-10-8-15(23)12-26-20/h3-12,24-25H,1-2H3,(H,27,29)(H,26,28,30)/b24-13+ |
| InChIKey | CSBDQTGVMSXHKD-ZMOGYAJESA-N |
| XLogP | 4.67 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|