C18H18ClN3O2 — CID 72687525
N-(5-chloro-2-pyridinyl)-2-(2-methylpent-2-enoylamino)benzamide (PubChem CID 72687525) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(2-methylpent-2-enoylamino)benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(2-methylpent-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 72687525 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(2-methylpent-2-enoylamino)benzamide |
| SMILES | CCC=C(C)C(=O)Nc1ccccc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-3-6-12(2)17(23)21-15-8-5-4-7-14(15)18(24)22-16-10-9-13(19)11-20-16/h4-11H,3H2,1-2H3,(H,21,23)(H,20,22,24) |
| InChIKey | MUFPNRBMQKZQRS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|