C20H20ClN3O5 — CID 142083403
2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(E)-2-methylpent-2-enoyl]amino]phenoxy]acetic acid (PubChem CID 142083403) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(E)-2-methylpent-2-enoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(E)-2-methylpent-2-enoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142083403 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(E)-2-methylpent-2-enoyl]amino]phenoxy]acetic acid |
| SMILES | CC/C=C(\C)C(=O)Nc1ccc(OCC(=O)O)cc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H20ClN3O5/c1-3-4-12(2)19(27)23-16-7-6-14(29-11-18(25)26)9-15(16)20(28)24-17-8-5-13(21)10-22-17/h4-10H,3,11H2,1-2H3,(H,23,27)(H,25,26)(H,22,24,28)/b12-4+ |
| InChIKey | SYKZSOVHBSYMLG-UUILKARUSA-N |
| XLogP | 3.75 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|