C25H24ClN5O5 — CID 66831458
methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-[(dimethylhydrazinylidene)methyl]benzoyl]amino]phenoxy]acetate (PubChem CID 66831458) has the molecular formula C25H24ClN5O5 and a molecular weight of 509.95 g/mol. Its IUPAC name is methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-[(dimethylhydrazinylidene)methyl]benzoyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-[(dimethylhydrazinylidene)methyl]benzoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 66831458 |
| Molecular Formula | C25H24ClN5O5 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-[(dimethylhydrazinylidene)methyl]benzoyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccc(C=NN(C)C)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C25H24ClN5O5/c1-31(2)28-13-16-4-6-17(7-5-16)24(33)29-21-10-9-19(36-15-23(32)35-3)12-20(21)25(34)30-22-11-8-18(26)14-27-22/h4-14H,15H2,1-3H3,(H,29,33)(H,27,30,34) |
| InChIKey | TWSOISNQNFESEO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|