C21H17ClN4O5 — CID 143758587
1-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 143758587) has the molecular formula C21H17ClN4O5 and a molecular weight of 440.84 g/mol. Its IUPAC name is 1-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 143758587 |
| Molecular Formula | C21H17ClN4O5 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C(=O)NO)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C21H17ClN4O5/c1-31-15-7-8-17(16(10-15)21(29)25-18-9-6-14(22)11-23-18)24-19(27)12-2-4-13(5-3-12)20(28)26-30/h2-11,30H,1H3,(H,24,27)(H,26,28)(H,23,25,29) |
| InChIKey | RGEVUCDHYKIBST-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|