C20H15Cl2N5O3 — CID 18727842
5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]benzamide (PubChem CID 18727842) has the molecular formula C20H15Cl2N5O3 and a molecular weight of 444.28 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 18727842 |
| Molecular Formula | C20H15Cl2N5O3 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]benzamide |
| SMILES | N/C(=N/O)c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O3/c21-13-5-7-16(15(9-13)20(29)26-17-8-6-14(22)10-24-17)25-19(28)12-3-1-11(2-4-12)18(23)27-30/h1-10,30H,(H2,23,27)(H,25,28)(H,24,26,29) |
| InChIKey | ICAWFWGENFQCIA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|