C23H21Cl2N5O2 — CID 44565603
5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide (PubChem CID 44565603) has the molecular formula C23H21Cl2N5O2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 44565603 |
| Molecular Formula | C23H21Cl2N5O2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)CC |
| InChI | InChI=1S/C23H21Cl2N5O2/c1-3-30(2)21(26)14-4-6-15(7-5-14)22(31)28-19-10-8-16(24)12-18(19)23(32)29-20-11-9-17(25)13-27-20/h4-13,26H,3H2,1-2H3,(H,28,31)(H,27,29,32)/b26-21- |
| InChIKey | LLAMURYENJSSJE-QLYXXIJNSA-N |
| XLogP | 5.17 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|