C25H24ClN5O4S — CID 21021794
methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetate (PubChem CID 21021794) has the molecular formula C25H24ClN5O4S and a molecular weight of 526.02 g/mol. Its IUPAC name is methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 21021794 |
| Molecular Formula | C25H24ClN5O4S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | methyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(SCC(=O)OC)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C25H24ClN5O4S/c1-31(2)23(27)15-4-6-16(7-5-15)24(33)29-20-10-9-18(36-14-22(32)35-3)12-19(20)25(34)30-21-11-8-17(26)13-28-21/h4-13,27H,14H2,1-3H3,(H,29,33)(H,28,30,34)/b27-23- |
| InChIKey | NMPGPLPJZMYMKV-VYIQYICTSA-N |
| XLogP | 4.39 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|