C38H50ClN7O5 — CID 129106452
N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-oxo-2-[6-(2,2,4-trimethylpentanoylamino)hexylamino]ethoxy]benzamide (PubChem CID 129106452) has the molecular formula C38H50ClN7O5 and a molecular weight of 720.32 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-oxo-2-[6-(2,2,4-trimethylpentanoylamino)hexylamino]ethoxy]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-oxo-2-[6-(2,2,4-trimethylpentanoylamino)hexylamino]ethoxy]benzamide |
|---|---|
| PubChem CID | 129106452 |
| Molecular Formula | C38H50ClN7O5 |
| Molecular Weight | 720.32 g/mol |
| Exact Mass | 719.36 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-oxo-2-[6-(2,2,4-trimethylpentanoylamino)hexylamino]ethoxy]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OCC(=O)NCCCCCCNC(=O)C(C)(C)CC(C)C)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C38H50ClN7O5/c1-25(2)22-38(3,4)37(50)42-20-10-8-7-9-19-41-33(47)24-51-29-16-17-31(30(21-29)36(49)45-32-18-15-28(39)23-43-32)44-35(48)27-13-11-26(12-14-27)34(40)46(5)6/h11-18,21,23,25,40H,7-10,19-20,22,24H2,1-6H3,(H,41,47)(H,42,50)(H,44,48)(H,43,45,49)/b40-34- |
| InChIKey | XNEIOJQEUJIZSA-UQQUJRAVSA-N |
| XLogP | 6.37 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.32 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|