C31H40ClN7O4 — CID 144662894
5-[2-(6-aminohexylamino)-2-oxoethoxy]-N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-6-methylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 144662894) has the molecular formula C31H40ClN7O4 and a molecular weight of 610.16 g/mol. Its IUPAC name is 5-[2-(6-aminohexylamino)-2-oxoethoxy]-N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-6-methylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 5-[2-(6-aminohexylamino)-2-oxoethoxy]-N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-6-methylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 144662894 |
| Molecular Formula | C31H40ClN7O4 |
| Molecular Weight | 610.16 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 5-[2-(6-aminohexylamino)-2-oxoethoxy]-N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-6-methylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)NC2=CC=C(OCC(=O)NCCCCCCN)C(C)C2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C31H40ClN7O4/c1-20-25(43-19-27(40)35-17-7-5-4-6-16-33)14-13-24(28(20)31(42)38-26-15-12-23(32)18-36-26)37-30(41)22-10-8-21(9-11-22)29(34)39(2)3/h8-15,18,20,28,34H,4-7,16-17,19,33H2,1-3H3,(H,35,40)(H,37,41)(H,36,38,42)/b34-29- |
| InChIKey | KRMPIFLTLFMGNE-BNIPGBBVSA-N |
| XLogP | 3.68 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|