C32H39ClN6O4 — CID 157411436
N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-(octylamino)-2-oxoethoxy]benzamide (PubChem CID 157411436) has the molecular formula C32H39ClN6O4 and a molecular weight of 607.16 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-(octylamino)-2-oxoethoxy]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-(octylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 157411436 |
| Molecular Formula | C32H39ClN6O4 |
| Molecular Weight | 607.16 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-[2-(octylamino)-2-oxoethoxy]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OCC(=O)NCCCCCCCC)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C32H39ClN6O4/c1-4-5-6-7-8-9-18-35-29(40)21-43-25-15-16-27(26(19-25)32(42)38-28-17-14-24(33)20-36-28)37-31(41)23-12-10-22(11-13-23)30(34)39(2)3/h10-17,19-20,34H,4-9,18,21H2,1-3H3,(H,35,40)(H,37,41)(H,36,38,42)/b34-30- |
| InChIKey | BCAGZALKQPVOLB-BVNFUTIRSA-N |
| XLogP | 5.98 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.16 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|