C26H25ClN4O2 — CID 59020871
5-chloro-N-(4-ethenylphenyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide (PubChem CID 59020871) has the molecular formula C26H25ClN4O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 5-chloro-N-(4-ethenylphenyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(4-ethenylphenyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 59020871 |
| Molecular Formula | C26H25ClN4O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-chloro-N-(4-ethenylphenyl)-2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(C=C)cc2)cc1)N(C)CC |
| InChI | InChI=1S/C26H25ClN4O2/c1-4-17-6-13-21(14-7-17)29-26(33)22-16-20(27)12-15-23(22)30-25(32)19-10-8-18(9-11-19)24(28)31(3)5-2/h4,6-16,28H,1,5H2,2-3H3,(H,29,33)(H,30,32)/b28-24- |
| InChIKey | RNDRGADAZVCWRA-COOPMVRXSA-N |
| XLogP | 5.76 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|