C20H14Cl2FN5O3 — CID 18727995
N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]benzamide (PubChem CID 18727995) has the molecular formula C20H14Cl2FN5O3 and a molecular weight of 462.27 g/mol. Its IUPAC name is N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]benzamide.
| Compound Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]benzamide |
|---|---|
| PubChem CID | 18727995 |
| Molecular Formula | C20H14Cl2FN5O3 |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]benzamide |
| SMILES | N/C(=N/O)c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C20H14Cl2FN5O3/c21-11-2-5-16(14(8-11)20(30)27-17-6-3-12(22)9-25-17)26-19(29)13-4-1-10(7-15(13)23)18(24)28-31/h1-9,31H,(H2,24,28)(H,26,29)(H,25,27,30) |
| InChIKey | GJCLHQIMQFYQCA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|