C27H31ClN4O5 — CID 142083438
ethane;ethyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(Z,2E)-6-cyano-2-ethylidenehex-4-enoyl]amino]phenoxy]acetate (PubChem CID 142083438) has the molecular formula C27H31ClN4O5 and a molecular weight of 527.02 g/mol. Its IUPAC name is ethane;ethyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(Z,2E)-6-cyano-2-ethylidenehex-4-enoyl]amino]phenoxy]acetate.
| Compound Name | ethane;ethyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(Z,2E)-6-cyano-2-ethylidenehex-4-enoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 142083438 |
| Molecular Formula | C27H31ClN4O5 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | ethane;ethyl 2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[(Z,2E)-6-cyano-2-ethylidenehex-4-enoyl]amino]phenoxy]acetate |
| SMILES | C/C=C(\C/C=C\CC#N)C(=O)Nc1ccc(OCC(=O)OCC)cc1C(=O)Nc1ccc(Cl)cn1.CC |
| InChI | InChI=1S/C25H25ClN4O5.C2H6/c1-3-17(8-6-5-7-13-27)24(32)29-21-11-10-19(35-16-23(31)34-4-2)14-20(21)25(33)30-22-12-9-18(26)15-28-22;1-2/h3,5-6,9-12,14-15H,4,7-8,16H2,1-2H3,(H,29,32)(H,28,30,33);1-2H3/b6-5-,17-3+; |
| InChIKey | COMUCEXDCBNNOB-VDCFVGPHSA-N |
| XLogP | 5.70 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|