C31H42ClN5O3 — CID 142083552
N-(5-chloro-2-pyridinyl)-2-[[(Z,2E)-2-ethylidene-9-imino-9-piperidin-1-ylnon-6-enoyl]amino]-5-methoxybenzamide;ethane (PubChem CID 142083552) has the molecular formula C31H42ClN5O3 and a molecular weight of 568.16 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[(Z,2E)-2-ethylidene-9-imino-9-piperidin-1-ylnon-6-enoyl]amino]-5-methoxybenzamide;ethane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[(Z,2E)-2-ethylidene-9-imino-9-piperidin-1-ylnon-6-enoyl]amino]-5-methoxybenzamide;ethane |
|---|---|
| PubChem CID | 142083552 |
| Molecular Formula | C31H42ClN5O3 |
| Molecular Weight | 568.16 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[(Z,2E)-2-ethylidene-9-imino-9-piperidin-1-ylnon-6-enoyl]amino]-5-methoxybenzamide;ethane |
| SMILES | CC.[H]/N=C(/C/C=C\CCC/C(=C\C)C(=O)Nc1ccc(OC)cc1C(=O)Nc1ccc(Cl)cn1)N1CCCCC1 |
| InChI | InChI=1S/C29H36ClN5O3.C2H6/c1-3-21(11-7-4-5-8-12-26(31)35-17-9-6-10-18-35)28(36)33-25-15-14-23(38-2)19-24(25)29(37)34-27-16-13-22(30)20-32-27;1-2/h3,5,8,13-16,19-20,31H,4,6-7,9-12,17-18H2,1-2H3,(H,33,36)(H,32,34,37);1-2H3/b8-5-,21-3+,31-26-; |
| InChIKey | LOFDQYSZAGBJOV-QTCAOHIHSA-N |
| XLogP | 7.49 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.16 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|