C26H27ClN4O3 — CID 134244076
N-(4-chlorophenyl)-2-[[hydroxy-[4-(pyrrolidine-1-carboximidoyl)phenyl]methyl]amino]-5-methoxybenzamide (PubChem CID 134244076) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[hydroxy-[4-(pyrrolidine-1-carboximidoyl)phenyl]methyl]amino]-5-methoxybenzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[hydroxy-[4-(pyrrolidine-1-carboximidoyl)phenyl]methyl]amino]-5-methoxybenzamide |
|---|---|
| PubChem CID | 134244076 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[hydroxy-[4-(pyrrolidine-1-carboximidoyl)phenyl]methyl]amino]-5-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(O)Nc2ccc(OC)cc2C(=O)Nc2ccc(Cl)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-34-21-12-13-23(22(16-21)26(33)29-20-10-8-19(27)9-11-20)30-25(32)18-6-4-17(5-7-18)24(28)31-14-2-3-15-31/h4-13,16,25,28,30,32H,2-3,14-15H2,1H3,(H,29,33)/b28-24- |
| InChIKey | OHSGDGYAUDWRPB-COOPMVRXSA-N |
| XLogP | 5.13 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|