C21H16Cl2N4O3 — CID 59089683
5-chloro-N-(5-chloro-2-pyridinyl)-2-[(4-ethanimidoylbenzoyl)amino]-3-hydroxybenzamide (PubChem CID 59089683) has the molecular formula C21H16Cl2N4O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[(4-ethanimidoylbenzoyl)amino]-3-hydroxybenzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[(4-ethanimidoylbenzoyl)amino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 59089683 |
| Molecular Formula | C21H16Cl2N4O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[(4-ethanimidoylbenzoyl)amino]-3-hydroxybenzamide |
| SMILES | [H]/N=C(\C)c1ccc(C(=O)Nc2c(O)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C21H16Cl2N4O3/c1-11(24)12-2-4-13(5-3-12)20(29)27-19-16(8-15(23)9-17(19)28)21(30)26-18-7-6-14(22)10-25-18/h2-10,24,28H,1H3,(H,27,29)(H,25,26,30)/b24-11+ |
| InChIKey | DFUMCMRLBYREKM-BHGWPJFGSA-N |
| XLogP | 4.99 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|