C22H19Cl2N5O3 — CID 18727880
5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxy-2-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]benzamide (PubChem CID 18727880) has the molecular formula C22H19Cl2N5O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxy-2-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxy-2-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 18727880 |
| Molecular Formula | C22H19Cl2N5O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxy-2-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]benzamide |
| SMILES | C/N=C(\N)c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C22H19Cl2N5O3/c1-26-20(25)12-3-5-13(6-4-12)21(30)29-19-16(9-15(24)10-17(19)32-2)22(31)28-18-8-7-14(23)11-27-18/h3-11H,1-2H3,(H2,25,26)(H,29,30)(H,27,28,31) |
| InChIKey | VVTXOXFSCXPKDC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|