C26H23ClN4O3Si — CID 142175187
5-chloro-2-[(4-cyanobenzoyl)amino]-3-methoxy-N-[5-(2-trimethylsilylethynyl)-2-pyridinyl]benzamide (PubChem CID 142175187) has the molecular formula C26H23ClN4O3Si and a molecular weight of 503.03 g/mol. Its IUPAC name is 5-chloro-2-[(4-cyanobenzoyl)amino]-3-methoxy-N-[5-(2-trimethylsilylethynyl)-2-pyridinyl]benzamide.
| Compound Name | 5-chloro-2-[(4-cyanobenzoyl)amino]-3-methoxy-N-[5-(2-trimethylsilylethynyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 142175187 |
| Molecular Formula | C26H23ClN4O3Si |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 5-chloro-2-[(4-cyanobenzoyl)amino]-3-methoxy-N-[5-(2-trimethylsilylethynyl)-2-pyridinyl]benzamide |
| SMILES | COc1cc(Cl)cc(C(=O)Nc2ccc(C#C[Si](C)(C)C)cn2)c1NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H23ClN4O3Si/c1-34-22-14-20(27)13-21(24(22)31-25(32)19-8-5-17(15-28)6-9-19)26(33)30-23-10-7-18(16-29-23)11-12-35(2,3)4/h5-10,13-14,16H,1-4H3,(H,31,32)(H,29,30,33) |
| InChIKey | AAFYNKODWKOPGR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|