C23H15ClN4O3 — CID 59020945
5-chloro-N-(5-ethynyl-2-pyridinyl)-2-[(4-isocyanobenzoyl)amino]-3-methoxybenzamide (PubChem CID 59020945) has the molecular formula C23H15ClN4O3 and a molecular weight of 430.85 g/mol. Its IUPAC name is 5-chloro-N-(5-ethynyl-2-pyridinyl)-2-[(4-isocyanobenzoyl)amino]-3-methoxybenzamide.
| Compound Name | 5-chloro-N-(5-ethynyl-2-pyridinyl)-2-[(4-isocyanobenzoyl)amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 59020945 |
| Molecular Formula | C23H15ClN4O3 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 5-chloro-N-(5-ethynyl-2-pyridinyl)-2-[(4-isocyanobenzoyl)amino]-3-methoxybenzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)cc1 |
| InChI | InChI=1S/C23H15ClN4O3/c1-4-14-5-10-20(26-13-14)27-23(30)18-11-16(24)12-19(31-3)21(18)28-22(29)15-6-8-17(25-2)9-7-15/h1,5-13H,3H3,(H,28,29)(H,26,27,30) |
| InChIKey | WDGDWQOBAGXVLP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|