C31H29ClFN5O5 — CID 59020919
ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxylate (PubChem CID 59020919) has the molecular formula C31H29ClFN5O5 and a molecular weight of 606.05 g/mol. Its IUPAC name is ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59020919 |
| Molecular Formula | C31H29ClFN5O5 |
| Molecular Weight | 606.05 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxylate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)c(F)c1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C31H29ClFN5O5/c1-4-18-6-9-26(35-17-18)36-30(40)23-15-21(32)16-25(42-3)27(23)37-29(39)22-8-7-20(14-24(22)33)28(34)38-12-10-19(11-13-38)31(41)43-5-2/h1,6-9,14-17,19,34H,5,10-13H2,2-3H3,(H,37,39)(H,35,36,40)/b34-28- |
| InChIKey | AMGKKMUNLCPMJT-BFYITVNDSA-N |
| XLogP | 4.97 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|