C28H29Cl2FN4O3 — CID 158673268
5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-3-methoxybenzamide;methane (PubChem CID 158673268) has the molecular formula C28H29Cl2FN4O3 and a molecular weight of 559.47 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-3-methoxybenzamide;methane.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-3-methoxybenzamide;methane |
|---|---|
| PubChem CID | 158673268 |
| Molecular Formula | C28H29Cl2FN4O3 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-3-methoxybenzamide;methane |
| SMILES | C.[H]/N=C(/c1ccc(C(=O)Cc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C27H25Cl2FN4O3.CH4/c1-37-24-13-18(29)12-21(27(36)33-25-8-6-17(28)15-32-25)20(24)14-23(35)19-7-5-16(11-22(19)30)26(31)34-9-3-2-4-10-34;/h5-8,11-13,15,31H,2-4,9-10,14H2,1H3,(H,32,33,36);1H4/b31-26-; |
| InChIKey | IEFAFVBRACBHMH-VSOZIWPHSA-N |
| XLogP | 6.66 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|