C25H20Cl2FN3O3 — CID 159611995
2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)-3-methoxybenzamide (PubChem CID 159611995) has the molecular formula C25H20Cl2FN3O3 and a molecular weight of 500.36 g/mol. Its IUPAC name is 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)-3-methoxybenzamide.
| Compound Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 159611995 |
| Molecular Formula | C25H20Cl2FN3O3 |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cc2)c(F)c1)N1CC1 |
| InChI | InChI=1S/C25H20Cl2FN3O3/c1-34-23-12-16(27)11-20(25(33)30-17-5-3-15(26)4-6-17)19(23)13-22(32)18-7-2-14(10-21(18)28)24(29)31-8-9-31/h2-7,10-12,29H,8-9,13H2,1H3,(H,30,33)/b29-24- |
| InChIKey | FOWSZZNIGXYJGO-OLFWJLLRSA-N |
| XLogP | 5.46 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|