C29H26ClFN6O4 — CID 59020883
1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxamide (PubChem CID 59020883) has the molecular formula C29H26ClFN6O4 and a molecular weight of 577.02 g/mol. Its IUPAC name is 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 59020883 |
| Molecular Formula | C29H26ClFN6O4 |
| Molecular Weight | 577.02 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorobenzenecarboximidoyl]piperidine-4-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)c(F)c1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C29H26ClFN6O4/c1-3-16-4-7-24(34-15-16)35-29(40)21-13-19(30)14-23(41-2)25(21)36-28(39)20-6-5-18(12-22(20)31)26(32)37-10-8-17(9-11-37)27(33)38/h1,4-7,12-15,17,32H,8-11H2,2H3,(H2,33,38)(H,36,39)(H,34,35,40)/b32-26- |
| InChIKey | NGRITIOTCMQANN-FSRJSHLRSA-N |
| XLogP | 3.89 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.02 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|