C29H27ClN4O3 — CID 59020874
5-chloro-N-(4-ethynylphenyl)-3-methoxy-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide (PubChem CID 59020874) has the molecular formula C29H27ClN4O3 and a molecular weight of 515.01 g/mol. Its IUPAC name is 5-chloro-N-(4-ethynylphenyl)-3-methoxy-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide.
| Compound Name | 5-chloro-N-(4-ethynylphenyl)-3-methoxy-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 59020874 |
| Molecular Formula | C29H27ClN4O3 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 5-chloro-N-(4-ethynylphenyl)-3-methoxy-2-[[4-(piperidine-1-carboximidoyl)benzoyl]amino]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C29H27ClN4O3/c1-3-19-7-13-23(14-8-19)32-29(36)24-17-22(30)18-25(37-2)26(24)33-28(35)21-11-9-20(10-12-21)27(31)34-15-5-4-6-16-34/h1,7-14,17-18,31H,4-6,15-16H2,2H3,(H,32,36)(H,33,35)/b31-27- |
| InChIKey | ZCUJMCWEFJSYOK-QVTSOHHYSA-N |
| XLogP | 5.65 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|