C29H29ClFN5O3 — CID 59020824
5-chloro-2-[[4-[N-[2-(dimethylamino)ethyl]-N-methylcarbamimidoyl]-2-fluorobenzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide (PubChem CID 59020824) has the molecular formula C29H29ClFN5O3 and a molecular weight of 550.03 g/mol. Its IUPAC name is 5-chloro-2-[[4-[N-[2-(dimethylamino)ethyl]-N-methylcarbamimidoyl]-2-fluorobenzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide.
| Compound Name | 5-chloro-2-[[4-[N-[2-(dimethylamino)ethyl]-N-methylcarbamimidoyl]-2-fluorobenzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 59020824 |
| Molecular Formula | C29H29ClFN5O3 |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 5-chloro-2-[[4-[N-[2-(dimethylamino)ethyl]-N-methylcarbamimidoyl]-2-fluorobenzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cc2)c(F)c1)N(C)CCN(C)C |
| InChI | InChI=1S/C29H29ClFN5O3/c1-6-18-7-10-21(11-8-18)33-29(38)23-16-20(30)17-25(39-5)26(23)34-28(37)22-12-9-19(15-24(22)31)27(32)36(4)14-13-35(2)3/h1,7-12,15-17,32H,13-14H2,2-5H3,(H,33,38)(H,34,37)/b32-27- |
| InChIKey | DQSPOOSBTAXCQR-MXNGAVTRSA-N |
| XLogP | 4.79 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|